cas: 153850-83-0 — see every product listed under this CAS number, including other names
4'-Chlorobiphenyl-2-carbaldehyde (CAS 153850-83-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014289-100MG |
| cas | 153850-83-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 830.98 Pln | |
| Fluorochem | 250mg | 1591.12 Pln | |
| Fluorochem | 1g | 4621.31 Pln |
| delivery time | 3-4 weeks |
|---|
2-(4-chlorophenyl)benzaldehyde (CAS 153850-83-0) is a chemical compound with the molecular formula C13H9ClO and a molecular weight of 216.66 g/mol. IUPAC name: 2-(4-chlorophenyl)benzaldehyde. InChIKey: IRBHAVWDSJLCAS-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 2-(4-chlorophenyl)benzaldehyde |
| InChIKey | IRBHAVWDSJLCAS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)