cas: 448-39-5 — see every product listed under this CAS number, including other names
4'-Fluoro-2'-nitroacetanilide, >98.0%(GC) (CAS 448-39-5) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | F0284-25G |
| cas | 448-39-5 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 305.20 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
N-(4-fluoro-2-nitrophenyl)acetamide (CAS 448-39-5) is a chemical compound with the molecular formula C8H7FN2O3 and a molecular weight of 198.15 g/mol. IUPAC name: N-(4-fluoro-2-nitrophenyl)acetamide. InChIKey: UZBZEUCQENVPQB-UHFFFAOYSA-N.
| Molecular formula | C8H7FN2O3 |
|---|---|
| Molecular weight | 198.15 g/mol |
| IUPAC name | N-(4-fluoro-2-nitrophenyl)acetamide |
| InChIKey | UZBZEUCQENVPQB-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)