CAS 1257997-37-7 is the registry number for Apalutamide Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-N-methyl-6-nitrobenzamide (CAS 1257997-37-7) is a chemical compound with the molecular formula C8H7FN2O3 and a molecular weight of 198.15 g/mol. IUPAC name: 2-fluoro-N-methyl-6-nitrobenzamide. InChIKey: CMJJGMFRKXSSQM-UHFFFAOYSA-N.
| Molecular formula | C8H7FN2O3 |
|---|---|
| Molecular weight | 198.15 g/mol |
| IUPAC name | 2-fluoro-N-methyl-6-nitrobenzamide |
| InChIKey | CMJJGMFRKXSSQM-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=C(C=CC=C1F)[N+](=O)[O-] |
Computed by PubChem (NCBI)