Products 1443425-13-5
CAS 1443425-13-5 is the registry number for 6-Fluoro-1h-benzimidazole-2-carboxylic acid hydrate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 100mg.
6-fluoro-1H-benzimidazole-2-carboxylic acid;hydrate (CAS 1443425-13-5) is a chemical compound with the molecular formula C8H7FN2O3 and a molecular weight of 198.15 g/mol. IUPAC name: 6-fluoro-1H-benzimidazole-2-carboxylic acid;hydrate. InChIKey: SZALCMJIMJPMOH-UHFFFAOYSA-N.
| Molecular formula | C8H7FN2O3 |
|---|---|
| Molecular weight | 198.15 g/mol |
| IUPAC name | 6-fluoro-1H-benzimidazole-2-carboxylic acid;hydrate |
| InChIKey | SZALCMJIMJPMOH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)NC(=N2)C(=O)O.O |
Computed by PubChem (NCBI)