CAS 136146-83-3 appears in our catalog under these names: 2-Fluoro-n-methyl-5-nitrobenzamide, 95%, 2-Fluoro-N-methyl-5-nitrobenzamide, 95+%, 2-Fluoro-N-methyl-5-nitrobenzamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 1g, 100mg.
2-fluoro-N-methyl-5-nitrobenzamide (CAS 136146-83-3) is a chemical compound with the molecular formula C8H7FN2O3 and a molecular weight of 198.15 g/mol. IUPAC name: 2-fluoro-N-methyl-5-nitrobenzamide. InChIKey: IGSVAMSQRNPSRN-UHFFFAOYSA-N.
| Molecular formula | C8H7FN2O3 |
|---|---|
| Molecular weight | 198.15 g/mol |
| IUPAC name | 2-fluoro-N-methyl-5-nitrobenzamide |
| InChIKey | IGSVAMSQRNPSRN-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)