Products 122138-83-4
CAS 122138-83-4 appears in our catalog under these names: 7-Fluoro-6-nitro-3,4-dihydro-2h-1,4-benzoxazine, 95%, 7-Fluoro-6-nitro-3,4-dihydro-2h-benzo(b)(1,4)oxazine, 95%, 7-Fluoro-6-nitro-3,4-dihydro-2H-1,4-benzoxazine, 97% . Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar). Available pack sizes: 250mg, 1g, 5g.
7-fluoro-6-nitro-3,4-dihydro-2H-1,4-benzoxazine (CAS 122138-83-4) is a chemical compound with the molecular formula C8H7FN2O3 and a molecular weight of 198.15 g/mol. IUPAC name: 7-fluoro-6-nitro-3,4-dihydro-2H-1,4-benzoxazine. InChIKey: PEOVRVSERLAIQM-UHFFFAOYSA-N.
| Molecular formula | C8H7FN2O3 |
|---|---|
| Molecular weight | 198.15 g/mol |
| IUPAC name | 7-fluoro-6-nitro-3,4-dihydro-2H-1,4-benzoxazine |
| InChIKey | PEOVRVSERLAIQM-UHFFFAOYSA-N |
| SMILES | C1COC2=CC(=C(C=C2N1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)