cas: 202752-04-3 — see every product listed under this CAS number, including other names
4'-Methoxy-(1,1'-biphenyl)-4-sulfonyl chloride, 95% (CAS 202752-04-3) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A100897-25g |
| cas | 202752-04-3 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 12237.19 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(4-methoxyphenyl)benzenesulfonyl chloride (CAS 202752-04-3) is a chemical compound with the molecular formula C13H11ClO3S and a molecular weight of 282.74 g/mol. IUPAC name: 4-(4-methoxyphenyl)benzenesulfonyl chloride. InChIKey: AJWXJCPSCXFPJJ-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO3S |
|---|---|
| Molecular weight | 282.74 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)benzenesulfonyl chloride |
| InChIKey | AJWXJCPSCXFPJJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)