Products 1261991-24-5
CAS 1261991-24-5 is the registry number for 2-Chloro-4-(4-methylsulfonylphenyl)phenol, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-chloro-4-(4-methylsulfonylphenyl)phenol (CAS 1261991-24-5) is a chemical compound with the molecular formula C13H11ClO3S and a molecular weight of 282.74 g/mol. IUPAC name: 2-chloro-4-(4-methylsulfonylphenyl)phenol. InChIKey: KFMZWXVTUIQXHG-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO3S |
|---|---|
| Molecular weight | 282.74 g/mol |
| IUPAC name | 2-chloro-4-(4-methylsulfonylphenyl)phenol |
| InChIKey | KFMZWXVTUIQXHG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C2=CC(=C(C=C2)O)Cl |
Computed by PubChem (NCBI)