Products 1261921-84-9
CAS 1261921-84-9 appears in our catalog under these names: 2-Chloro-5-(3-methylsulfonylphenyl)phenol, 97%, 4-Chloro-3'-(methylsulfonyl)-(1,1'-biphenyl)-3-ol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
2-chloro-5-(3-methylsulfonylphenyl)phenol (CAS 1261921-84-9) is a chemical compound with the molecular formula C13H11ClO3S and a molecular weight of 282.74 g/mol. IUPAC name: 2-chloro-5-(3-methylsulfonylphenyl)phenol. InChIKey: WVJBXFYKZKNTCV-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO3S |
|---|---|
| Molecular weight | 282.74 g/mol |
| IUPAC name | 2-chloro-5-(3-methylsulfonylphenyl)phenol |
| InChIKey | WVJBXFYKZKNTCV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1)C2=CC(=C(C=C2)Cl)O |
Computed by PubChem (NCBI)