CAS 202752-04-3 appears in our catalog under these names: 4'-Methoxy[1,1'-biphenyl]-4-sulfonyl chloride, 95%, 4'-Methoxy-(1,1'-biphenyl)-4-sulfonyl chloride, 95%, 4'-Methoxy[1,1'-biphenyl]-4-sulfonyl chloride, 97% , 4'-METHOXYBIPHENYL-4-SULFONYL CHLORIDE,&. Offered by: Combi-blocks, AmBeed, Thermo Scientific, Sigma-Aldrich. Available pack sizes: 1g, 250mg, 25g, 10g.
4-(4-methoxyphenyl)benzenesulfonyl chloride (CAS 202752-04-3) is a chemical compound with the molecular formula C13H11ClO3S and a molecular weight of 282.74 g/mol. IUPAC name: 4-(4-methoxyphenyl)benzenesulfonyl chloride. InChIKey: AJWXJCPSCXFPJJ-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO3S |
|---|---|
| Molecular weight | 282.74 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)benzenesulfonyl chloride |
| InChIKey | AJWXJCPSCXFPJJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)