CAS 186550-26-5 appears in our catalog under these names: 3'-Methoxybiphenyl-4-sulfonyl chloride, 95%, 3'-Methoxy-(1,1'-biphenyl)-4-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Acros). Available pack sizes: 250mg, 5g, 1g.
4-(3-methoxyphenyl)benzenesulfonyl chloride (CAS 186550-26-5) is a chemical compound with the molecular formula C13H11ClO3S and a molecular weight of 282.74 g/mol. IUPAC name: 4-(3-methoxyphenyl)benzenesulfonyl chloride. InChIKey: DVQBUJTYQXKLKZ-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO3S |
|---|---|
| Molecular weight | 282.74 g/mol |
| IUPAC name | 4-(3-methoxyphenyl)benzenesulfonyl chloride |
| InChIKey | DVQBUJTYQXKLKZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)