CAS 6118-51-0 appears in our catalog under these names: exo–3,6–Epoxy–1,2,3,6–tetrahydrophthalic Anhydride, exo-7-Oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic anhydride, exo-3,6-Epoxy-1,2,3,6-tetrahydrophthalic Anhydride, >98.0%(T), exo-3,6-Epoxy-1,2,3,6-tetrahydrophthalic Anhydride 95%, EXO-3,6-EPOXY-1,2,3,6-TETRAHYDROPHTHALI. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 500g, 25g, 5g, 1000g, 10g, 250g, 1g.
(1S,2R,6S,7R)-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (CAS 6118-51-0) is a chemical compound with the molecular formula C8H6O4 and a molecular weight of 166.13 g/mol. IUPAC name: (1S,2R,6S,7R)-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione. InChIKey: QQYNRBAAQFZCLF-FBXFSONDSA-N.
| Molecular formula | C8H6O4 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | (1S,2R,6S,7R)-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| InChIKey | QQYNRBAAQFZCLF-FBXFSONDSA-N |
| SMILES | C1=C[C@H]2[C@H]3[C@@H]([C@@H]1O2)C(=O)OC3=O |
Computed by PubChem (NCBI)