4,4',4''-(1,3,5-Triazine-2,4,6-triyl)triphenol, 98%
cas: 7753-13-1 — see every product listed under this CAS number, including other names
4,4',4''-(1,3,5-Triazine-2,4,6-triyl)triphenol, 98% (CAS 7753-13-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1444676-100mg |
| cas | 7753-13-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 214.62 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 843.19 Pln | |
| Ambeed | 25g | 2773.38 Pln | |
| BLDpharm | 100mg | 197.73 Pln | |
| BLDpharm | 250mg | 286.59 Pln | |
| BLDpharm | 1g | 331.02 Pln | |
| BLDpharm | 5g | 903.04 Pln | |
| BLDpharm | 25g | 2985.64 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-[4,6-bis(4-hydroxyphenyl)-1,3,5-triazin-2-yl]phenol (CAS 7753-13-1) is a chemical compound with the molecular formula C21H15N3O3 and a molecular weight of 357.4 g/mol. IUPAC name: 4-[4,6-bis(4-hydroxyphenyl)-1,3,5-triazin-2-yl]phenol. InChIKey: GPSBTCCYBACYRE-UHFFFAOYSA-N.
| Molecular formula | C21H15N3O3 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 4-[4,6-bis(4-hydroxyphenyl)-1,3,5-triazin-2-yl]phenol |
| InChIKey | GPSBTCCYBACYRE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NC(=N2)C3=CC=C(C=C3)O)C4=CC=C(C=C4)O)O |
Computed by PubChem (NCBI)
Synonyms:
4,4',4''-(1,3,5-Triazine-2,4,6-triyl)triphenol, Phenol, 4,4',4''-(1,3,5-triazine-2,4,6-triyl)tris-, starbld0005810, 4-[4,6-bis(4-hydroxyphenyl)-1,3,5-triazin-2-yl]phenol, 2,4,6-Tris(4-hydroxyphenyl)-1,3,5-triazine, Febuxostat Impurity 115, Phenol,4,4',4''-(1,3,5-triaz, 4,4',4''-(1,3,5-Triazinane-2,4,6-triylidene)tri(cyclohexa-2,5-dien-1-one)
