CAS 7753-13-1 appears in our catalog under these names: 4,4',4''–(1,3,5–Triazine–2,4,6–triyl)triphenol, 4,4',4''-(1,3,5-Triazine-2,4,6-triyl)triphenol, 97%, 97%, 4,4',4''-(1,3,5-Triazine-2,4,6-triyl)triphenol, 96%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 25g.
4-[4,6-bis(4-hydroxyphenyl)-1,3,5-triazin-2-yl]phenol (CAS 7753-13-1) is a chemical compound with the molecular formula C21H15N3O3 and a molecular weight of 357.4 g/mol. IUPAC name: 4-[4,6-bis(4-hydroxyphenyl)-1,3,5-triazin-2-yl]phenol. InChIKey: GPSBTCCYBACYRE-UHFFFAOYSA-N.
| Molecular formula | C21H15N3O3 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 4-[4,6-bis(4-hydroxyphenyl)-1,3,5-triazin-2-yl]phenol |
| InChIKey | GPSBTCCYBACYRE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NC(=N2)C3=CC=C(C=C3)O)C4=CC=C(C=C4)O)O |
Computed by PubChem (NCBI)