CAS 2225834-22-8 appears in our catalog under these names: 3,3',3''-(1,3,5-Triazine-2,4,6-triyl)triphenol, 95%, 95%, 3,3',3''-(1,3,5-Triazine-2,4,6-triyl)triphenol, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
3-[4,6-bis(3-hydroxyphenyl)-1,3,5-triazin-2-yl]phenol (CAS 2225834-22-8) is a chemical compound with the molecular formula C21H15N3O3 and a molecular weight of 357.4 g/mol. IUPAC name: 3-[4,6-bis(3-hydroxyphenyl)-1,3,5-triazin-2-yl]phenol. InChIKey: VNIZEYVBKJDTFO-UHFFFAOYSA-N.
| Molecular formula | C21H15N3O3 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 3-[4,6-bis(3-hydroxyphenyl)-1,3,5-triazin-2-yl]phenol |
| InChIKey | VNIZEYVBKJDTFO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C2=NC(=NC(=N2)C3=CC(=CC=C3)O)C4=CC(=CC=C4)O |
Computed by PubChem (NCBI)