cas: 6052-15-9 — see every product listed under this CAS number, including other names
4,4'–(Ethyne–1,2–diyl)dianiline (CAS 6052-15-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB55600-100 |
| cas | 6052-15-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 615.76 Pln | |
| GLPBio | 1g | 1252.31 Pln | |
| GLPBio | 250mg | 695.33 Pln | |
| GLPBio | 5g | 3775.10 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
4-[2-(4-aminophenyl)ethynyl]aniline (CAS 6052-15-9) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 4-[2-(4-aminophenyl)ethynyl]aniline. InChIKey: WAUKJWLKPXRNKT-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 4-[2-(4-aminophenyl)ethynyl]aniline |
| InChIKey | WAUKJWLKPXRNKT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#CC2=CC=C(C=C2)N)N |
Computed by PubChem (NCBI)