cas: 6052-15-9 — see every product listed under this CAS number, including other names
4,4'-(Ethyne-1,2-diyl)dianiline, 98% (CAS 6052-15-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F608881-250MG |
| cas | 6052-15-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 346.77 Pln | |
| Fluorochem | 5g | 1315.18 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-[2-(4-aminophenyl)ethynyl]aniline (CAS 6052-15-9) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 4-[2-(4-aminophenyl)ethynyl]aniline. InChIKey: WAUKJWLKPXRNKT-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 4-[2-(4-aminophenyl)ethynyl]aniline |
| InChIKey | WAUKJWLKPXRNKT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#CC2=CC=C(C=C2)N)N |
Computed by PubChem (NCBI)