cas: 3406-84-6 — see every product listed under this CAS number, including other names
4,4'–Biphenyldisulfonyl Chloride (CAS 3406-84-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB55686-10g |
| cas | 3406-84-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 1589.31 Pln | |
| GLPBio | 1g | 634.48 Pln | |
| GLPBio | 25g | 2782.83 Pln | |
| GLPBio | 5g | 1102.53 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(4-chlorosulfonylphenyl)benzenesulfonyl chloride (CAS 3406-84-6) is a chemical compound with the molecular formula C12H8Cl2O4S2 and a molecular weight of 351.2 g/mol. IUPAC name: 4-(4-chlorosulfonylphenyl)benzenesulfonyl chloride. InChIKey: OTFAWEIFBPUXOH-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O4S2 |
|---|---|
| Molecular weight | 351.2 g/mol |
| IUPAC name | 4-(4-chlorosulfonylphenyl)benzenesulfonyl chloride |
| InChIKey | OTFAWEIFBPUXOH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)S(=O)(=O)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)