cas: 3406-84-6 — see every product listed under this CAS number, including other names
4,4'-Biphenyldisulfonyl Chloride, >97.0%(T)(qNMR) (CAS 3406-84-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B1165-5G |
| cas | 3406-84-6 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 301.77 Pln | |
| TCI | 25g | 1054.11 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(T)(qNMR) |
4-(4-chlorosulfonylphenyl)benzenesulfonyl chloride (CAS 3406-84-6) is a chemical compound with the molecular formula C12H8Cl2O4S2 and a molecular weight of 351.2 g/mol. IUPAC name: 4-(4-chlorosulfonylphenyl)benzenesulfonyl chloride. InChIKey: OTFAWEIFBPUXOH-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O4S2 |
|---|---|
| Molecular weight | 351.2 g/mol |
| IUPAC name | 4-(4-chlorosulfonylphenyl)benzenesulfonyl chloride |
| InChIKey | OTFAWEIFBPUXOH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)S(=O)(=O)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)