cas: 3406-84-6 — see every product listed under this CAS number, including other names
BIPHENYL-4,4'-DISULFONYL DICHLORIDE, 95% (CAS 3406-84-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F471919-1G |
| cas | 3406-84-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 393.63 Pln | |
| Fluorochem | 10g | 690.40 Pln | |
| Fluorochem | 25g | 1080.89 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-(4-chlorosulfonylphenyl)benzenesulfonyl chloride (CAS 3406-84-6) is a chemical compound with the molecular formula C12H8Cl2O4S2 and a molecular weight of 351.2 g/mol. IUPAC name: 4-(4-chlorosulfonylphenyl)benzenesulfonyl chloride. InChIKey: OTFAWEIFBPUXOH-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O4S2 |
|---|---|
| Molecular weight | 351.2 g/mol |
| IUPAC name | 4-(4-chlorosulfonylphenyl)benzenesulfonyl chloride |
| InChIKey | OTFAWEIFBPUXOH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)S(=O)(=O)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)