cas: 3753-05-7 — see every product listed under this CAS number, including other names
4,4'-(Ethane-1,2-diylbis(oxy))dibenzoic acid, 95%, 95% (CAS 3753-05-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114QIA-100mg |
| cas | 3753-05-7 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 659.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-[2-(4-carboxyphenoxy)ethoxy]benzoic acid (CAS 3753-05-7) is a chemical compound with the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. IUPAC name: 4-[2-(4-carboxyphenoxy)ethoxy]benzoic acid. InChIKey: VAXBLYWAVAIJJJ-UHFFFAOYSA-N.
| Molecular formula | C16H14O6 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | 4-[2-(4-carboxyphenoxy)ethoxy]benzoic acid |
| InChIKey | VAXBLYWAVAIJJJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OCCOC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)