4,4'-Di-tert-butyl-[1,1'-biphenyl]-2-amine, 98%
cas: 70728-92-6 — see every product listed under this CAS number, including other names
4,4'-Di-tert-butyl-[1,1'-biphenyl]-2-amine, 98% (CAS 70728-92-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F899514-1G |
| cas | 70728-92-6 |
| size | 1g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 294.71 Pln | |
| Fluorochem | 25g | 799.74 Pln | |
| Ambeed | 1g | 142.31 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 25g | 670.75 Pln | |
| Ambeed | 100g | 2000.19 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 203.60 Pln | |
| Chemat | 25g | 554.00 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 258.82 Pln | |
| BLDpharm | 25g | 719.77 Pln | |
| BLDpharm | 100g | 2152.60 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
5-tert-butyl-2-(4-tert-butylphenyl)aniline (CAS 70728-92-6) is a chemical compound with the molecular formula C20H27N and a molecular weight of 281.4 g/mol. IUPAC name: 5-tert-butyl-2-(4-tert-butylphenyl)aniline. InChIKey: WVXFKSSZPMFWAZ-UHFFFAOYSA-N.
| Molecular formula | C20H27N |
|---|---|
| Molecular weight | 281.4 g/mol |
| IUPAC name | 5-tert-butyl-2-(4-tert-butylphenyl)aniline |
| InChIKey | WVXFKSSZPMFWAZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=C(C=C(C=C2)C(C)(C)C)N |
Computed by PubChem (NCBI)