Products 58164-04-8
CAS 58164-04-8 is the registry number for Bis(3-tert-butylphenyl)amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
3-tert-butyl-N-(3-tert-butylphenyl)aniline (CAS 58164-04-8) is a chemical compound with the molecular formula C20H27N and a molecular weight of 281.4 g/mol. IUPAC name: 3-tert-butyl-N-(3-tert-butylphenyl)aniline. InChIKey: KHNPQCFQKCRNKS-UHFFFAOYSA-N.
| Molecular formula | C20H27N |
|---|---|
| Molecular weight | 281.4 g/mol |
| IUPAC name | 3-tert-butyl-N-(3-tert-butylphenyl)aniline |
| InChIKey | KHNPQCFQKCRNKS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC=C1)NC2=CC=CC(=C2)C(C)(C)C |
Computed by PubChem (NCBI)