CAS 2262575-15-3 is the registry number for 4',5-Di-tert-butyl-[1,1'-biphenyl]-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
4-tert-butyl-2-(4-tert-butylphenyl)aniline (CAS 2262575-15-3) is a chemical compound with the molecular formula C20H27N and a molecular weight of 281.4 g/mol. IUPAC name: 4-tert-butyl-2-(4-tert-butylphenyl)aniline. InChIKey: ODZBOWNEYXGNHD-UHFFFAOYSA-N.
| Molecular formula | C20H27N |
|---|---|
| Molecular weight | 281.4 g/mol |
| IUPAC name | 4-tert-butyl-2-(4-tert-butylphenyl)aniline |
| InChIKey | ODZBOWNEYXGNHD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=C(C=CC(=C2)C(C)(C)C)N |
Computed by PubChem (NCBI)