CAS 70728-92-6 appears in our catalog under these names: 4,4'-Di-tert-butyl-[1,1'-biphenyl]-2-amine 98%, 4,4'-Di-tert-butyl-[1,1'-biphenyl]-2-amine, 98%, 98%, 4,4'-Di-tert-butyl-[1,1'-biphenyl]-2-amine, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g.
5-tert-butyl-2-(4-tert-butylphenyl)aniline (CAS 70728-92-6) is a chemical compound with the molecular formula C20H27N and a molecular weight of 281.4 g/mol. IUPAC name: 5-tert-butyl-2-(4-tert-butylphenyl)aniline. InChIKey: WVXFKSSZPMFWAZ-UHFFFAOYSA-N.
| Molecular formula | C20H27N |
|---|---|
| Molecular weight | 281.4 g/mol |
| IUPAC name | 5-tert-butyl-2-(4-tert-butylphenyl)aniline |
| InChIKey | WVXFKSSZPMFWAZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=C(C=C(C=C2)C(C)(C)C)N |
Computed by PubChem (NCBI)