Products 2897657-01-9
CAS 2897657-01-9 is the registry number for 3',5'-di-tert-Butyl-[1,1'-biphenyl]-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(3,5-ditert-butylphenyl)aniline (CAS 2897657-01-9) is a chemical compound with the molecular formula C20H27N and a molecular weight of 281.4 g/mol. IUPAC name: 2-(3,5-ditert-butylphenyl)aniline. InChIKey: RTHXMMJENDYHKC-UHFFFAOYSA-N.
| Molecular formula | C20H27N |
|---|---|
| Molecular weight | 281.4 g/mol |
| IUPAC name | 2-(3,5-ditert-butylphenyl)aniline |
| InChIKey | RTHXMMJENDYHKC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)C2=CC=CC=C2N)C(C)(C)C |
Computed by PubChem (NCBI)