cas: 785-30-8 — see every product listed under this CAS number, including other names
4,4'-Diaminobenzanilide, >98.0%(HPLC)(T) (CAS 785-30-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2005-25G |
| cas | 785-30-8 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 113.43 Pln | |
| TCI | 500g | 614.99 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
4-amino-N-(4-aminophenyl)benzamide (CAS 785-30-8) is a chemical compound with the molecular formula C13H13N3O and a molecular weight of 227.26 g/mol. IUPAC name: 4-amino-N-(4-aminophenyl)benzamide. InChIKey: XPAQFJJCWGSXGJ-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 4-amino-N-(4-aminophenyl)benzamide |
| InChIKey | XPAQFJJCWGSXGJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC2=CC=C(C=C2)N)N |
Computed by PubChem (NCBI)