cas: 785-30-8 — see every product listed under this CAS number, including other names
4-Amino-N-(4-aminophenyl)benzamide 98% (CAS 785-30-8) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A105356-100g |
| cas | 785-30-8 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 225.75 Pln | |
| Ambeed | 500g | 782.00 Pln | |
| Ambeed | 1000g | 1282.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A105356 |
4-amino-N-(4-aminophenyl)benzamide (CAS 785-30-8) is a chemical compound with the molecular formula C13H13N3O and a molecular weight of 227.26 g/mol. IUPAC name: 4-amino-N-(4-aminophenyl)benzamide. InChIKey: XPAQFJJCWGSXGJ-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 4-amino-N-(4-aminophenyl)benzamide |
| InChIKey | XPAQFJJCWGSXGJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC2=CC=C(C=C2)N)N |
Computed by PubChem (NCBI)