cas: 785-30-8 — see every product listed under this CAS number, including other names
4-Amino-N-(4-aminophenyl)benzamide, 98%, 98% (CAS 785-30-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 50g, 100g, 500g, 1kg, 2.5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116A1Z-5g |
| cas | 785-30-8 |
| size | 5g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 50g | 112.40 Pln | |
| Chemat | 100g | 112.40 Pln | |
| Chemat | 500g | 374.40 Pln | |
| Chemat | 1kg | 664.40 Pln | |
| Chemat | 2.5kg | 1399.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-amino-N-(4-aminophenyl)benzamide (CAS 785-30-8) is a chemical compound with the molecular formula C13H13N3O and a molecular weight of 227.26 g/mol. IUPAC name: 4-amino-N-(4-aminophenyl)benzamide. InChIKey: XPAQFJJCWGSXGJ-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 4-amino-N-(4-aminophenyl)benzamide |
| InChIKey | XPAQFJJCWGSXGJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC2=CC=C(C=C2)N)N |
Computed by PubChem (NCBI)