CAS 1762-41-0 appears in our catalog under these names: 4,4'-Dichloro-2,2'-bipyridine, 4,4'-Dichloro-2,2'-bipyridine, min. 95 %, 2 g, 4,4'-Dichloro-2,2'-bipyridine, min. 95 %, 5 g, 4,4'-Dichloro-2,2'-bipyridine, min. 95 %, 10 g, 4,4'-Dichloro-2,2'-bipyridine, min. 95 %, 25 g. Offered by: Biosynth, Roth, Fluorochem. Available pack sizes: 5g, 2g, 10g, 25g, 50g, 100mg, 250mg, 1g.
4-chloro-2-(4-chloro-2-pyridinyl)pyridine (CAS 1762-41-0) is a chemical compound with the molecular formula C10H6Cl2N2 and a molecular weight of 225.07 g/mol. IUPAC name: 4-chloro-2-(4-chloro-2-pyridinyl)pyridine. InChIKey: UBSRTSGCWBPLQF-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 4-chloro-2-(4-chloro-2-pyridinyl)pyridine |
| InChIKey | UBSRTSGCWBPLQF-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1Cl)C2=NC=CC(=C2)Cl |
Computed by PubChem (NCBI)