cas: 611-97-2 — see every product listed under this CAS number, including other names
4,4'-Dimethylbenzophenone, >99.0%(GC) (CAS 611-97-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D0685-5G |
| cas | 611-97-2 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 147.85 Pln | |
| TCI | 25g | 433.05 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >99.0%(GC) |
Bis(4-methylphenyl)methanone (CAS 611-97-2) is a chemical compound with the molecular formula C15H14O and a molecular weight of 210.27 g/mol. IUPAC name: bis(4-methylphenyl)methanone. InChIKey: ZWPWLKXZYNXATK-UHFFFAOYSA-N.
| Molecular formula | C15H14O |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | bis(4-methylphenyl)methanone |
| InChIKey | ZWPWLKXZYNXATK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)