CAS 611-97-2 appears in our catalog under these names: 4,4'-Dimethylbenzophenone, 97%, 97%, 4,4'-Dimethylbenzophenone 97%, 4,4'-Dimethylbenzophenone, 97%, 4,4'-Dimethylbenzophenone, 98%, 4,4'–Dimethylbenzophenone. Offered by: Chemat, Ambeed, Fluorochem, Combi-blocks, GLPBio. Available pack sizes: 1kg, 5g, 10g, 25g, 100g, 500g, 1000g, 1g.
Bis(4-methylphenyl)methanone (CAS 611-97-2) is a chemical compound with the molecular formula C15H14O and a molecular weight of 210.27 g/mol. IUPAC name: bis(4-methylphenyl)methanone. InChIKey: ZWPWLKXZYNXATK-UHFFFAOYSA-N.
| Molecular formula | C15H14O |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | bis(4-methylphenyl)methanone |
| InChIKey | ZWPWLKXZYNXATK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)