cas: 611-97-2 — see every product listed under this CAS number, including other names
4,4'-Dimethylbenzophenone, 97%, 97% (CAS 611-97-2) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KG2-1kg |
| cas | 611-97-2 |
| size | 1kg |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 818.00 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 126.80 Pln | |
| Chemat | 500g | 451.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Bis(4-methylphenyl)methanone (CAS 611-97-2) is a chemical compound with the molecular formula C15H14O and a molecular weight of 210.27 g/mol. IUPAC name: bis(4-methylphenyl)methanone. InChIKey: ZWPWLKXZYNXATK-UHFFFAOYSA-N.
| Molecular formula | C15H14O |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | bis(4-methylphenyl)methanone |
| InChIKey | ZWPWLKXZYNXATK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)