cas: 4073-98-7 — see every product listed under this CAS number, including other names
4-(4-Amino-3,5-dimethylbenzyl)-2,6-dimethylaniline (CAS 4073-98-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 50g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F227924-1G |
| cas | 4073-98-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 10g | 247.85 Pln | |
| Fluorochem | 50g | 752.88 Pln | |
| Fluorochem | 100g | 1388.07 Pln |
| delivery time | 3-4 weeks |
|---|
4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylaniline (CAS 4073-98-7) is a chemical compound with the molecular formula C17H22N2 and a molecular weight of 254.37 g/mol. IUPAC name: 4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylaniline. InChIKey: OMHOXRVODFQGCA-UHFFFAOYSA-N.
| Molecular formula | C17H22N2 |
|---|---|
| Molecular weight | 254.37 g/mol |
| IUPAC name | 4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylaniline |
| InChIKey | OMHOXRVODFQGCA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)C)CC2=CC(=C(C(=C2)C)N)C |
Computed by PubChem (NCBI)