cas: 4073-98-7 — see every product listed under this CAS number, including other names
4,4-Methylenebis(2,6-dimethylaniline), 97%, 97% (CAS 4073-98-7) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I8ZM-500g |
| cas | 4073-98-7 |
| size | 500g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500g | 4636.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 150.80 Pln | |
| Chemat | 25g | 366.80 Pln | |
| Chemat | 100g | 1187.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylaniline (CAS 4073-98-7) is a chemical compound with the molecular formula C17H22N2 and a molecular weight of 254.37 g/mol. IUPAC name: 4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylaniline. InChIKey: OMHOXRVODFQGCA-UHFFFAOYSA-N.
| Molecular formula | C17H22N2 |
|---|---|
| Molecular weight | 254.37 g/mol |
| IUPAC name | 4-[(4-amino-3,5-dimethylphenyl)methyl]-2,6-dimethylaniline |
| InChIKey | OMHOXRVODFQGCA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)C)CC2=CC(=C(C(=C2)C)N)C |
Computed by PubChem (NCBI)