4,4'-Oxybis(fluorobenzene), 95%
cas: 330-93-8 — see every product listed under this CAS number, including other names
4,4'-Oxybis(fluorobenzene), 95% (CAS 330-93-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A298105-250mg |
| cas | 330-93-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 259.12 Pln | |
| Ambeed | 10g | 403.75 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 438.80 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 142.20 Pln | |
| BLDpharm | 5g | 275.48 Pln | |
| BLDpharm | 10g | 430.98 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-fluoro-4-(4-fluorophenoxy)benzene (CAS 330-93-8) is a chemical compound with the molecular formula C12H8F2O and a molecular weight of 206.19 g/mol. IUPAC name: 1-fluoro-4-(4-fluorophenoxy)benzene. InChIKey: UUKHFGSOCZLVJO-UHFFFAOYSA-N.
| Molecular formula | C12H8F2O |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 1-fluoro-4-(4-fluorophenoxy)benzene |
| InChIKey | UUKHFGSOCZLVJO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=CC=C(C=C2)F)F |
Computed by PubChem (NCBI)
Synonyms:
Bis(4-fluorophenyl) Ether, 4,4'-Difluorodiphenyl Ether, p-fluorophenyl ether, 1,1'-Oxybis(4-fluorobenzene), Bis(p-fluorophenyl) ether, Benzene, 1,1'-oxybis(4-fluoro-, 1,1'-Oxybis[4-fluorobenzene], ETHER, BIS(P-FLUOROPHENYL), Benzene, 1,1'-oxybis[4-fluoro-, Benzene, 1,1'-oxybis(4-fluoro-(9CI)