Products 330-93-8
CAS 330-93-8 appears in our catalog under these names: Bis(4–fluorophenyl) Ether, Bis(4-fluorophenyl) Ether, >98.0%(GC), Bis(4-fluorophenyl) ether, 95%, 4,4'-Oxybis(fluorobenzene), 95%. Offered by: GLPBio, TCI, Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g.
1-fluoro-4-(4-fluorophenoxy)benzene (CAS 330-93-8) is a chemical compound with the molecular formula C12H8F2O and a molecular weight of 206.19 g/mol. IUPAC name: 1-fluoro-4-(4-fluorophenoxy)benzene. InChIKey: UUKHFGSOCZLVJO-UHFFFAOYSA-N.
| Molecular formula | C12H8F2O |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 1-fluoro-4-(4-fluorophenoxy)benzene |
| InChIKey | UUKHFGSOCZLVJO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=CC=C(C=C2)F)F |
Computed by PubChem (NCBI)
Synonyms:
Bis(4-fluorophenyl) Ether, 4,4'-Difluorodiphenyl Ether, p-fluorophenyl ether, 1,1'-Oxybis(4-fluorobenzene), Bis(p-fluorophenyl) ether, Benzene, 1,1'-oxybis(4-fluoro-, 1,1'-Oxybis[4-fluorobenzene], ETHER, BIS(P-FLUOROPHENYL), Benzene, 1,1'-oxybis[4-fluoro-, Benzene, 1,1'-oxybis(4-fluoro-(9CI)