4,4,5,5-Tetramethyl-2-(2-methyl-4-(methylsulfonyl)phenyl)-1,3,2-dioxaborolane, 97%
cas: 1011459-26-9 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(2-methyl-4-(methylsulfonyl)phenyl)-1,3,2-dioxaborolane, 97% (CAS 1011459-26-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A789724-100mg |
| cas | 1011459-26-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 826.50 Pln | |
| Ambeed | 5g | 2539.75 Pln | |
| BLDpharm | 100mg | 292.14 Pln | |
| BLDpharm | 250mg | 386.56 Pln | |
| BLDpharm | 1g | 886.38 Pln | |
| BLDpharm | 5g | 2735.73 Pln | |
| Fluorochem | 100mg | 445.69 Pln | |
| Fluorochem | 250mg | 695.61 Pln | |
| Fluorochem | 1g | 1700.46 Pln | |
| Fluorochem | 5g | 5709.47 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4,4,5,5-tetramethyl-2-(2-methyl-4-methylsulfonylphenyl)-1,3,2-dioxaborolane (CAS 1011459-26-9) is a chemical compound with the molecular formula C14H21BO4S and a molecular weight of 296.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-methyl-4-methylsulfonylphenyl)-1,3,2-dioxaborolane. InChIKey: NDJPXOFQIJCADG-UHFFFAOYSA-N.
| Molecular formula | C14H21BO4S |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-methyl-4-methylsulfonylphenyl)-1,3,2-dioxaborolane |
| InChIKey | NDJPXOFQIJCADG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)S(=O)(=O)C)C |
Computed by PubChem (NCBI)
Synonyms:
4,4,5,5-tetramethyl-2-(2-methyl-4-(methylsulfonyl)phenyl)-1,3,2-dioxaborolane, 4-Methanesulfonyl-2-methylphenylboronic acid pinacol ester, 4,4,5,5-tetramethyl-2-(2-methyl-4-methylsulfonylphenyl)-1,3,2-dioxaborolane, 2-Methyl-4-(methylsulfonyl)phenylboronic Acid Pinacol Ester, NDJPXOFQIJCADG-UHFFFAOYSA-N, 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[2-methyl-4-(methylsulfonyl)phenyl]-, 2-(4-methanesulfonyl-2-methyl-phenyl)-4,4,5,5-tetramethyl-[1,3,2]dioxaborolane, 4,4,5,5-tetramethyl-2-(2-methyl-4-methylsulfonyl-phenyl)-1,3,2-dioxaborolane