CAS 1011459-26-9 appears in our catalog under these names: 4-Methanesulfonyl-2-methylphenylboronic acid pinacol ester, 97%, 97%, 4,4,5,5-Tetramethyl-2-(2-methyl-4-(methylsulfonyl)phenyl)-1,3,2-dioxaborolane, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4,4,5,5-tetramethyl-2-(2-methyl-4-methylsulfonylphenyl)-1,3,2-dioxaborolane (CAS 1011459-26-9) is a chemical compound with the molecular formula C14H21BO4S and a molecular weight of 296.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-methyl-4-methylsulfonylphenyl)-1,3,2-dioxaborolane. InChIKey: NDJPXOFQIJCADG-UHFFFAOYSA-N.
| Molecular formula | C14H21BO4S |
|---|---|
| Molecular weight | 296.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-methyl-4-methylsulfonylphenyl)-1,3,2-dioxaborolane |
| InChIKey | NDJPXOFQIJCADG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)S(=O)(=O)C)C |
Computed by PubChem (NCBI)