cas: 627526-50-5 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(4-methylnaphthalen-1-yl)-1,3,2-dioxaborolane, 97% (CAS 627526-50-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F217355-250MG |
| cas | 627526-50-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 846.59 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4,4,5,5-tetramethyl-2-(4-methylnaphthalen-1-yl)-1,3,2-dioxaborolane (CAS 627526-50-5) is a chemical compound with the molecular formula C17H21BO2 and a molecular weight of 268.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-methylnaphthalen-1-yl)-1,3,2-dioxaborolane. InChIKey: RSCPKFFLZXEPLB-UHFFFAOYSA-N.
| Molecular formula | C17H21BO2 |
|---|---|
| Molecular weight | 268.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-methylnaphthalen-1-yl)-1,3,2-dioxaborolane |
| InChIKey | RSCPKFFLZXEPLB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C3=CC=CC=C23)C |
Computed by PubChem (NCBI)