cas: 627526-50-5 — see every product listed under this CAS number, including other names
4-Methylnaphthalene-1-boronic acid, pinacol ester, 98%, 98% (CAS 627526-50-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EKP9-100mg |
| cas | 627526-50-5 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 726.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-(4-methylnaphthalen-1-yl)-1,3,2-dioxaborolane (CAS 627526-50-5) is a chemical compound with the molecular formula C17H21BO2 and a molecular weight of 268.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-methylnaphthalen-1-yl)-1,3,2-dioxaborolane. InChIKey: RSCPKFFLZXEPLB-UHFFFAOYSA-N.
| Molecular formula | C17H21BO2 |
|---|---|
| Molecular weight | 268.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-methylnaphthalen-1-yl)-1,3,2-dioxaborolane |
| InChIKey | RSCPKFFLZXEPLB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C3=CC=CC=C23)C |
Computed by PubChem (NCBI)