cas: 635305-48-5 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(4-methylthiophen-2-yl)-1,3,2-dioxaborolane, 97% (CAS 635305-48-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F318054-5G |
| cas | 635305-48-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 10g | 508.17 Pln | |
| Fluorochem | 25g | 1195.43 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4,4,5,5-tetramethyl-2-(4-methylthiophen-2-yl)-1,3,2-dioxaborolane (CAS 635305-48-5) is a chemical compound with the molecular formula C11H17BO2S and a molecular weight of 224.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-methylthiophen-2-yl)-1,3,2-dioxaborolane. InChIKey: FNRMPXJVCSMVMA-UHFFFAOYSA-N.
| Molecular formula | C11H17BO2S |
|---|---|
| Molecular weight | 224.13 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-methylthiophen-2-yl)-1,3,2-dioxaborolane |
| InChIKey | FNRMPXJVCSMVMA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CS2)C |
Computed by PubChem (NCBI)