Products 952022-28-5
CAS 952022-28-5 is the registry number for 2-(2,5-Dimethylthiophen-3-yl)-5,5-dimethyl-1,3,2-dioxaborinane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,5-dimethylthiophen-3-yl)-5,5-dimethyl-1,3,2-dioxaborinane (CAS 952022-28-5) is a chemical compound with the molecular formula C11H17BO2S and a molecular weight of 224.13 g/mol. IUPAC name: 2-(2,5-dimethylthiophen-3-yl)-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: DBAOACWEYQGISE-UHFFFAOYSA-N.
| Molecular formula | C11H17BO2S |
|---|---|
| Molecular weight | 224.13 g/mol |
| IUPAC name | 2-(2,5-dimethylthiophen-3-yl)-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | DBAOACWEYQGISE-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=C(SC(=C2)C)C |
Computed by PubChem (NCBI)