Products 1444010-65-4
CAS 1444010-65-4 is the registry number for 4,4,5,5-Tetramethyl-2-(thiophen-3-ylmethyl)-1,3,2-dioxaborolane, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg.
4,4,5,5-tetramethyl-2-(thiophen-3-ylmethyl)-1,3,2-dioxaborolane (CAS 1444010-65-4) is a chemical compound with the molecular formula C11H17BO2S and a molecular weight of 224.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(thiophen-3-ylmethyl)-1,3,2-dioxaborolane. InChIKey: UKMKCLDSWUHLDY-UHFFFAOYSA-N.
| Molecular formula | C11H17BO2S |
|---|---|
| Molecular weight | 224.13 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(thiophen-3-ylmethyl)-1,3,2-dioxaborolane |
| InChIKey | UKMKCLDSWUHLDY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CSC=C2 |
Computed by PubChem (NCBI)