cas: 929031-44-7 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,3,2-dioxaborolane (CAS 929031-44-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F692958-250MG |
| cas | 929031-44-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1757.73 Pln | |
| Fluorochem | 5g | 11233.56 Pln | |
| Fluorochem | 10g | 17195.00 Pln |
| delivery time | 3-4 weeks |
|---|
4,4,5,5-tetramethyl-2-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,3,2-dioxaborolane (CAS 929031-44-7) is a chemical compound with the molecular formula C16H23BO2 and a molecular weight of 258.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,3,2-dioxaborolane. InChIKey: ZEQMAKMHBSNXHC-UHFFFAOYSA-N.
| Molecular formula | C16H23BO2 |
|---|---|
| Molecular weight | 258.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,3,2-dioxaborolane |
| InChIKey | ZEQMAKMHBSNXHC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3CCCCC3=CC=C2 |
Computed by PubChem (NCBI)