cas: 929031-44-7 — see every product listed under this CAS number, including other names
5,6,7,8-TEtrahydronaphthalene-1-boronic acid pinacol ester 95% (CAS 929031-44-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A742389-100mg |
| cas | 929031-44-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 715.25 Pln | |
| Ambeed | 250mg | 1204.75 Pln | |
| Ambeed | 1g | 3757.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A742389 |
4,4,5,5-tetramethyl-2-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,3,2-dioxaborolane (CAS 929031-44-7) is a chemical compound with the molecular formula C16H23BO2 and a molecular weight of 258.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,3,2-dioxaborolane. InChIKey: ZEQMAKMHBSNXHC-UHFFFAOYSA-N.
| Molecular formula | C16H23BO2 |
|---|---|
| Molecular weight | 258.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,3,2-dioxaborolane |
| InChIKey | ZEQMAKMHBSNXHC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3CCCCC3=CC=C2 |
Computed by PubChem (NCBI)