4,4,5,5-Tetramethyl-2-(phenanthren-2-yl)-1,3,2-dioxaborolane, 98%
cas: 895137-83-4 — see every product listed under this CAS number, including other names
4,4,5,5-Tetramethyl-2-(phenanthren-2-yl)-1,3,2-dioxaborolane, 98% (CAS 895137-83-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1694918-100mg |
| cas | 895137-83-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 587.31 Pln | |
| Ambeed | 250mg | 898.81 Pln | |
| Ambeed | 1g | 2962.50 Pln | |
| Ambeed | 5g | 11651.12 Pln | |
| BLDpharm | 100mg | 630.91 Pln | |
| BLDpharm | 250mg | 964.13 Pln | |
| BLDpharm | 1g | 2913.44 Pln | |
| BLDpharm | 5g | 11432.67 Pln | |
| Chemat | 250mg | 899.60 Pln | |
| Chemat | 1g | 2234.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
4,4,5,5-tetramethyl-2-phenanthren-2-yl-1,3,2-dioxaborolane (CAS 895137-83-4) is a chemical compound with the molecular formula C20H21BO2 and a molecular weight of 304.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-phenanthren-2-yl-1,3,2-dioxaborolane. InChIKey: ICESCNGNKLTYAZ-UHFFFAOYSA-N.
| Molecular formula | C20H21BO2 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-phenanthren-2-yl-1,3,2-dioxaborolane |
| InChIKey | ICESCNGNKLTYAZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)