CAS 1835207-09-4 is the registry number for 4,4,5,5-Tetramethyl-2-(phenanthren-1-yl)-1,3,2-dioxaborolane, 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
4,4,5,5-tetramethyl-2-phenanthren-1-yl-1,3,2-dioxaborolane (CAS 1835207-09-4) is a chemical compound with the molecular formula C20H21BO2 and a molecular weight of 304.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-phenanthren-1-yl-1,3,2-dioxaborolane. InChIKey: AWDRVUXLPXBLMZ-UHFFFAOYSA-N.
| Molecular formula | C20H21BO2 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-phenanthren-1-yl-1,3,2-dioxaborolane |
| InChIKey | AWDRVUXLPXBLMZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=CC4=CC=CC=C4C3=CC=C2 |
Computed by PubChem (NCBI)