CAS 676578-20-4 appears in our catalog under these names: 1,3,2–Dioxaborolane, 2–(2–anthracenyl)–4,4,5,5–tetramethyl–, 2-(Anthracen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%, 2-(Anthracen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-anthracen-2-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 676578-20-4) is a chemical compound with the molecular formula C20H21BO2 and a molecular weight of 304.2 g/mol. IUPAC name: 2-anthracen-2-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: PHGAEOZJPSSSIV-UHFFFAOYSA-N.
| Molecular formula | C20H21BO2 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | 2-anthracen-2-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | PHGAEOZJPSSSIV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=CC4=CC=CC=C4C=C3C=C2 |
Computed by PubChem (NCBI)