CAS 709022-63-9 appears in our catalog under these names: 9-Anthraceneboronic acid pinacol ester, 95-<97%, 9-Anthraceneboronic acid pinacol ester, ≥97-<99%, 2–(9–Anthryl)–4,4,5,5–tetramethyl–1,3,2–dioxaborolane, 2-(9-Anthryl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >98.0%(GC), 2-(Anthracen-9-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%. Offered by: Hoffman Fine Chemicals, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 50g, 100g, 200g, 300g, 400g, 500g, 1g, 5g.
2-anthracen-9-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 709022-63-9) is a chemical compound with the molecular formula C20H21BO2 and a molecular weight of 304.2 g/mol. IUPAC name: 2-anthracen-9-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GBHRGHJTZFOAKE-UHFFFAOYSA-N.
| Molecular formula | C20H21BO2 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | 2-anthracen-9-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GBHRGHJTZFOAKE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=CC=CC3=CC4=CC=CC=C24 |
Computed by PubChem (NCBI)